C17H23N3O4 — CID 16718474
2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-hydroxy-3-methylpentanamide (PubChem CID 16718474) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-hydroxy-3-methylpentanamide.
| Compound Name | 2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-hydroxy-3-methylpentanamide |
|---|---|
| PubChem CID | 16718474 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-hydroxy-3-methylpentanamide |
| SMILES | CCC(C)C(C(=O)NO)N1C(=O)NC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C17H23N3O4/c1-3-11(2)14(15(21)19-24)20-16(22)13(18-17(20)23)10-9-12-7-5-4-6-8-12/h4-8,11,13-14,24H,3,9-10H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | YEXPZJBDXICEMU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|