C27H30F2N6O5S — CID 143485311
N-[2-[[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]-5-methoxyphenyl]-1-methylpyrrolidine-2-carboxamide (PubChem CID 143485311) has the molecular formula C27H30F2N6O5S and a molecular weight of 588.64 g/mol. Its IUPAC name is N-[2-[[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]-5-methoxyphenyl]-1-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-[[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]-5-methoxyphenyl]-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143485311 |
| Molecular Formula | C27H30F2N6O5S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | N-[2-[[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]carbamoyl]-5-methoxyphenyl]-1-methylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2n[nH]c3c2CN(S(=O)(=O)c2cc(F)cc(F)c2)C3(C)C)c(NC(=O)C2CCCN2C)c1 |
| InChI | InChI=1S/C27H30F2N6O5S/c1-27(2)23-20(14-35(27)41(38,39)18-11-15(28)10-16(29)12-18)24(33-32-23)31-25(36)19-8-7-17(40-4)13-21(19)30-26(37)22-6-5-9-34(22)3/h7-8,10-13,22H,5-6,9,14H2,1-4H3,(H,30,37)(H2,31,32,33,36) |
| InChIKey | ARGDQPQFMBDGRZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |