C28H34F2N8O4S — CID 68985303
2-(2-aminopropanoylamino)-N-[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 68985303) has the molecular formula C28H34F2N8O4S and a molecular weight of 616.70 g/mol. Its IUPAC name is 2-(2-aminopropanoylamino)-N-[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 2-(2-aminopropanoylamino)-N-[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68985303 |
| Molecular Formula | C28H34F2N8O4S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 2-(2-aminopropanoylamino)-N-[5-(3,5-difluorophenyl)sulfonyl-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CC(N)C(=O)Nc1cc(N2CCN(C)CC2)ccc1C(=O)Nc1n[nH]c2c1CN(S(=O)(=O)c1cc(F)cc(F)c1)C2(C)C |
| InChI | InChI=1S/C28H34F2N8O4S/c1-16(31)26(39)32-23-14-19(37-9-7-36(4)8-10-37)5-6-21(23)27(40)33-25-22-15-38(28(2,3)24(22)34-35-25)43(41,42)20-12-17(29)11-18(30)13-20/h5-6,11-14,16H,7-10,15,31H2,1-4H3,(H,32,39)(H2,33,34,35,40) |
| InChIKey | GFERBHBFOHOXPE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |