C13H30N2O2 — CID 143487005
molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane (PubChem CID 143487005) has the molecular formula C13H30N2O2 and a molecular weight of 246.39 g/mol. Its IUPAC name is molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane.
| Compound Name | molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane |
|---|---|
| PubChem CID | 143487005 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane |
| SMILES | CCC.CC[C@H](C[C@H]1CCCOC1)NC(N)=O.[H][H] |
| InChI | InChI=1S/C10H20N2O2.C3H8.H2/c1-2-9(12-10(11)13)6-8-4-3-5-14-7-8;1-3-2;/h8-9H,2-7H2,1H3,(H3,11,12,13);3H2,1-2H3;1H/t8-,9-;;/m1../s1 |
| InChIKey | IJWSXRRAYCSNRR-UONRGADFSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |