About molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane
molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane (PubChem CID 143487005) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane.
Molecular Properties
| Compound Name | molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane |
| PubChem CID | 143487005 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane |
| SMILES | CCC.CC[C@H](C[C@H]1CCCOC1)NC(N)=O.[H][H] |
| InChI | InChI=1S/C10H20N2O2.C3H8.H2/c1-2-9(12-10(11)13)6-8-4-3-5-14-7-8;1-3-2;/h8-9H,2-7H2,1H3,(H3,11,12,13);3H2,1-2H3;1H/t8-,9-;;/m1../s1 |
| InChIKey | IJWSXRRAYCSNRR-UONRGADFSA-N |
| XLogP | 2.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane?
The IUPAC name of molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane (CID 143487005) is molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane.
What is the SMILES notation for molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane?
The canonical SMILES for molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane is CCC.CC[C@H](C[C@H]1CCCOC1)NC(N)=O.[H][H].
What is the InChIKey of molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane?
The InChIKey is IJWSXRRAYCSNRR-UONRGADFSA-N. The full InChI is InChI=1S/C10H20N2O2.C3H8.H2/c1-2-9(12-10(11)13)6-8-4-3-5-14-7-8;1-3-2;/h8-9H,2-7H2,1H3,(H3,11,12,13);3H2,1-2H3;1H/t8-,9-;;/m1../s1.
What are the key properties of molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane?
molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane has a molecular weight of 246.39 g/mol, XLogP of 2.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;[(2R)-1-[(3R)-oxan-3-yl]butan-2-yl]urea;propane is sourced from PubChem (CID 143487005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).