C13H22N2O — CID 143487062
(3R)-3-(cyclohex-3-en-1-ylmethyl)-4-(methylamino)-2-methylidenebutanamide (PubChem CID 143487062) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (3R)-3-(cyclohex-3-en-1-ylmethyl)-4-(methylamino)-2-methylidenebutanamide.
| Compound Name | (3R)-3-(cyclohex-3-en-1-ylmethyl)-4-(methylamino)-2-methylidenebutanamide |
|---|---|
| PubChem CID | 143487062 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (3R)-3-(cyclohex-3-en-1-ylmethyl)-4-(methylamino)-2-methylidenebutanamide |
| SMILES | C=C(C(N)=O)[C@H](CNC)CC1CC=CCC1 |
| InChI | InChI=1S/C13H22N2O/c1-10(13(14)16)12(9-15-2)8-11-6-4-3-5-7-11/h3-4,11-12,15H,1,5-9H2,2H3,(H2,14,16)/t11?,12-/m0/s1 |
| InChIKey | LATKUENVLJHTAZ-KIYNQFGBSA-N |
| XLogP | 1.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|