C17H31NO — CID 58650855
(4R)-N-methyl-4,5,6-tri(propan-2-yl)cyclohexene-1-carboxamide (PubChem CID 58650855) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (4R)-N-methyl-4,5,6-tri(propan-2-yl)cyclohexene-1-carboxamide.
| Compound Name | (4R)-N-methyl-4,5,6-tri(propan-2-yl)cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 58650855 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (4R)-N-methyl-4,5,6-tri(propan-2-yl)cyclohexene-1-carboxamide |
| SMILES | CNC(=O)C1=CC[C@H](C(C)C)C(C(C)C)C1C(C)C |
| InChI | InChI=1S/C17H31NO/c1-10(2)13-8-9-14(17(19)18-7)16(12(5)6)15(13)11(3)4/h9-13,15-16H,8H2,1-7H3,(H,18,19)/t13-,15?,16?/m1/s1 |
| InChIKey | DOKGSEZDJUPTAZ-IUDNXUCKSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |