C24H23N3O — CID 143487175
3-[1,4-dimethyl-3-[1-(2-methylprop-2-enylamino)ethenyl]-2-oxoquinolin-7-yl]benzonitrile (PubChem CID 143487175) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[1,4-dimethyl-3-[1-(2-methylprop-2-enylamino)ethenyl]-2-oxoquinolin-7-yl]benzonitrile.
| Compound Name | 3-[1,4-dimethyl-3-[1-(2-methylprop-2-enylamino)ethenyl]-2-oxoquinolin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 143487175 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[1,4-dimethyl-3-[1-(2-methylprop-2-enylamino)ethenyl]-2-oxoquinolin-7-yl]benzonitrile |
| SMILES | C=C(C)CNC(=C)c1c(C)c2ccc(-c3cccc(C#N)c3)cc2n(C)c1=O |
| InChI | InChI=1S/C24H23N3O/c1-15(2)14-26-17(4)23-16(3)21-10-9-20(12-22(21)27(5)24(23)28)19-8-6-7-18(11-19)13-25/h6-12,26H,1,4,14H2,2-3,5H3 |
| InChIKey | NDIQVYUAGBSONL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|