C15H28N2 — CID 143488750
(6E)-5-[(E)-but-2-en-2-yl]-6-methyl-N-propyl-1,2,3,4,5,8-hexahydroazocin-7-amine (PubChem CID 143488750) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (6E)-5-[(E)-but-2-en-2-yl]-6-methyl-N-propyl-1,2,3,4,5,8-hexahydroazocin-7-amine.
| Compound Name | (6E)-5-[(E)-but-2-en-2-yl]-6-methyl-N-propyl-1,2,3,4,5,8-hexahydroazocin-7-amine |
|---|---|
| PubChem CID | 143488750 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (6E)-5-[(E)-but-2-en-2-yl]-6-methyl-N-propyl-1,2,3,4,5,8-hexahydroazocin-7-amine |
| SMILES | C/C=C(\C)C1CCCNC/C(NCCC)=C\1C |
| InChI | InChI=1S/C15H28N2/c1-5-9-17-15-11-16-10-7-8-14(13(15)4)12(3)6-2/h6,14,16-17H,5,7-11H2,1-4H3/b12-6+,15-13+ |
| InChIKey | URYMLIXBCICEBP-SXQUACMQSA-N |
| XLogP | 3.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|