C17H25N5O — CID 143489039
4-[4-(2-amino-3-ethenyl-4-pyridinyl)pyrazol-1-yl]-4-methylpentanal;methanamine (PubChem CID 143489039) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[4-(2-amino-3-ethenyl-4-pyridinyl)pyrazol-1-yl]-4-methylpentanal;methanamine.
| Compound Name | 4-[4-(2-amino-3-ethenyl-4-pyridinyl)pyrazol-1-yl]-4-methylpentanal;methanamine |
|---|---|
| PubChem CID | 143489039 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 4-[4-(2-amino-3-ethenyl-4-pyridinyl)pyrazol-1-yl]-4-methylpentanal;methanamine |
| SMILES | C=Cc1c(-c2cnn(C(C)(C)CCC=O)c2)ccnc1N.CN |
| InChI | InChI=1S/C16H20N4O.CH5N/c1-4-13-14(6-8-18-15(13)17)12-10-19-20(11-12)16(2,3)7-5-9-21;1-2/h4,6,8-11H,1,5,7H2,2-3H3,(H2,17,18);2H2,1H3 |
| InChIKey | YKXKGHGQXSUCEZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|