About N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine
N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine (PubChem CID 143489271) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine.
Molecular Properties
| Compound Name | N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine |
| PubChem CID | 143489271 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine |
| SMILES | C[C@@H]1NCCC[C@@H]1CNCc1ccccc1 |
| InChI | InChI=1S/C14H22N2/c1-12-14(8-5-9-16-12)11-15-10-13-6-3-2-4-7-13/h2-4,6-7,12,14-16H,5,8-11H2,1H3/t12-,14+/m0/s1 |
| InChIKey | GCEBHAQPZREKKR-GXTWGEPZSA-N |
| XLogP | 2.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine?
The IUPAC name of N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine (CID 143489271) is N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine.
What is the SMILES notation for N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine?
The canonical SMILES for N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine is C[C@@H]1NCCC[C@@H]1CNCc1ccccc1.
What is the InChIKey of N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine?
The InChIKey is GCEBHAQPZREKKR-GXTWGEPZSA-N. The full InChI is InChI=1S/C14H22N2/c1-12-14(8-5-9-16-12)11-15-10-13-6-3-2-4-7-13/h2-4,6-7,12,14-16H,5,8-11H2,1H3/t12-,14+/m0/s1.
What are the key properties of N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine?
N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine has a molecular weight of 218.34 g/mol, XLogP of 2.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine is sourced from PubChem (CID 143489271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).