C14H22N2 — CID 143489271
N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine (PubChem CID 143489271) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine.
| Compound Name | N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 143489271 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N-benzyl-1-[(2S,3R)-2-methylpiperidin-3-yl]methanamine |
| SMILES | C[C@@H]1NCCC[C@@H]1CNCc1ccccc1 |
| InChI | InChI=1S/C14H22N2/c1-12-14(8-5-9-16-12)11-15-10-13-6-3-2-4-7-13/h2-4,6-7,12,14-16H,5,8-11H2,1H3/t12-,14+/m0/s1 |
| InChIKey | GCEBHAQPZREKKR-GXTWGEPZSA-N |
| XLogP | 2.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |