About 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine
2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine (PubChem CID 67003274) has the molecular formula C21H30N2
and a molecular weight of 310.49 g/mol. Its IUPAC name is 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine.
Molecular Properties
| Compound Name | 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine |
| PubChem CID | 67003274 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine |
| SMILES | CC1CCCN1.c1ccc(CCNCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19N.C5H11N/c1-3-7-15(8-4-1)11-13-17-14-12-16-9-5-2-6-10-16;1-5-3-2-4-6-5/h1-10,17H,11-14H2;5-6H,2-4H2,1H3 |
| InChIKey | DASPWXUSACCWLY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine?
The IUPAC name of 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine (CID 67003274) is 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine.
What is the SMILES notation for 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine?
The canonical SMILES for 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine is CC1CCCN1.c1ccc(CCNCCc2ccccc2)cc1.
What is the InChIKey of 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine?
The InChIKey is DASPWXUSACCWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N.C5H11N/c1-3-7-15(8-4-1)11-13-17-14-12-16-9-5-2-6-10-16;1-5-3-2-4-6-5/h1-10,17H,11-14H2;5-6H,2-4H2,1H3.
What are the key properties of 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine?
2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine has a molecular weight of 310.49 g/mol, XLogP of 3.82, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrrolidine;2-phenyl-N-(2-phenylethyl)ethanamine is sourced from PubChem (CID 67003274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).