C18H19BFN5O — CID 143489321
1-[3-[(4-cyano-1,4-azaborinan-1-yl)methyl]-2-fluorophenyl]-3-pyridin-3-ylurea (PubChem CID 143489321) has the molecular formula C18H19BFN5O and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-[3-[(4-cyano-1,4-azaborinan-1-yl)methyl]-2-fluorophenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[3-[(4-cyano-1,4-azaborinan-1-yl)methyl]-2-fluorophenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 143489321 |
| Molecular Formula | C18H19BFN5O |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-[3-[(4-cyano-1,4-azaborinan-1-yl)methyl]-2-fluorophenyl]-3-pyridin-3-ylurea |
| SMILES | N#CB1CCN(Cc2cccc(NC(=O)Nc3cccnc3)c2F)CC1 |
| InChI | InChI=1S/C18H19BFN5O/c20-17-14(12-25-9-6-19(13-21)7-10-25)3-1-5-16(17)24-18(26)23-15-4-2-8-22-11-15/h1-5,8,11H,6-7,9-10,12H2,(H2,23,24,26) |
| InChIKey | XSMQDNBNAAJLEN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|