C18H22FN5O3S — CID 174539782
[4-[[2-fluoro-3-(pyridin-3-ylcarbamoylamino)phenyl]methyl]piperazin-1-yl]methanesulfinic acid (PubChem CID 174539782) has the molecular formula C18H22FN5O3S and a molecular weight of 407.47 g/mol. Its IUPAC name is [4-[[2-fluoro-3-(pyridin-3-ylcarbamoylamino)phenyl]methyl]piperazin-1-yl]methanesulfinic acid.
| Compound Name | [4-[[2-fluoro-3-(pyridin-3-ylcarbamoylamino)phenyl]methyl]piperazin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174539782 |
| Molecular Formula | C18H22FN5O3S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [4-[[2-fluoro-3-(pyridin-3-ylcarbamoylamino)phenyl]methyl]piperazin-1-yl]methanesulfinic acid |
| SMILES | O=C(Nc1cccnc1)Nc1cccc(CN2CCN(CS(=O)O)CC2)c1F |
| InChI | InChI=1S/C18H22FN5O3S/c19-17-14(12-23-7-9-24(10-8-23)13-28(26)27)3-1-5-16(17)22-18(25)21-15-4-2-6-20-11-15/h1-6,11H,7-10,12-13H2,(H,26,27)(H2,21,22,25) |
| InChIKey | WOUQYENCFOYTOC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|