About 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane
3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane (PubChem CID 143489580) has the molecular formula C17H20N2O
and a molecular weight of 268.36 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane |
| PubChem CID | 143489580 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane |
| SMILES | C.Cc1cccc(C(=O)N2CCCc3cnccc32)c1 |
| InChI | InChI=1S/C16H16N2O.CH4/c1-12-4-2-5-13(10-12)16(19)18-9-3-6-14-11-17-8-7-15(14)18;/h2,4-5,7-8,10-11H,3,6,9H2,1H3;1H4 |
| InChIKey | HTUFBMUWWSJDIZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane?
The IUPAC name of 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane (CID 143489580) is 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane.
What is the SMILES notation for 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane?
The canonical SMILES for 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane is C.Cc1cccc(C(=O)N2CCCc3cnccc32)c1.
What is the InChIKey of 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane?
The InChIKey is HTUFBMUWWSJDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O.CH4/c1-12-4-2-5-13(10-12)16(19)18-9-3-6-14-11-17-8-7-15(14)18;/h2,4-5,7-8,10-11H,3,6,9H2,1H3;1H4.
What are the key properties of 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane?
3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane has a molecular weight of 268.36 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,6-naphthyridin-1-yl-(3-methylphenyl)methanone;methane is sourced from PubChem (CID 143489580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).