About 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine
7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine (PubChem CID 143490971) has the molecular formula C11H13NS2
and a molecular weight of 223.37 g/mol. Its IUPAC name is 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine.
Molecular Properties
| Compound Name | 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine |
| PubChem CID | 143490971 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine |
| SMILES | CSC1CC=C(C2=CC=CCC=N2)S1 |
| InChI | InChI=1S/C11H13NS2/c1-13-11-7-6-10(14-11)9-5-3-2-4-8-12-9/h2-3,5-6,8,11H,4,7H2,1H3 |
| InChIKey | MDNQDBSFMFPFSN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
The IUPAC name of 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine (CID 143490971) is 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine.
What is the SMILES notation for 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
The canonical SMILES for 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine is CSC1CC=C(C2=CC=CCC=N2)S1.
What is the InChIKey of 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
The InChIKey is MDNQDBSFMFPFSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS2/c1-13-11-7-6-10(14-11)9-5-3-2-4-8-12-9/h2-3,5-6,8,11H,4,7H2,1H3.
What are the key properties of 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine has a molecular weight of 223.37 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine is sourced from PubChem (CID 143490971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).