About ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine
ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine (PubChem CID 143490970) has the molecular formula C15H25NS2
and a molecular weight of 283.51 g/mol. Its IUPAC name is ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine.
Molecular Properties
| Compound Name | ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine |
| PubChem CID | 143490970 |
| Molecular Formula | C15H25NS2 |
| Molecular Weight | 283.51 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine |
| SMILES | CC.CC.CSC1CC=C(C2=CC=CCC=N2)S1 |
| InChI | InChI=1S/C11H13NS2.2C2H6/c1-13-11-7-6-10(14-11)9-5-3-2-4-8-12-9;2*1-2/h2-3,5-6,8,11H,4,7H2,1H3;2*1-2H3 |
| InChIKey | ZCYVURDLTADXRA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
The IUPAC name of ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine (CID 143490970) is ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine.
What is the SMILES notation for ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
The canonical SMILES for ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine is CC.CC.CSC1CC=C(C2=CC=CCC=N2)S1.
What is the InChIKey of ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
The InChIKey is ZCYVURDLTADXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS2.2C2H6/c1-13-11-7-6-10(14-11)9-5-3-2-4-8-12-9;2*1-2/h2-3,5-6,8,11H,4,7H2,1H3;2*1-2H3.
What are the key properties of ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine?
ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine has a molecular weight of 283.51 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-(2-methylsulfanyl-2,3-dihydrothiophen-5-yl)-3H-azepine is sourced from PubChem (CID 143490970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).