C14H25NS — CID 143157766
N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine;ethane (PubChem CID 143157766) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine;ethane.
| Compound Name | N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 143157766 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine;ethane |
| SMILES | C=C/C=N/C(=C)C1=CCCCS1.CC.CC |
| InChI | InChI=1S/C10H13NS.2C2H6/c1-3-7-11-9(2)10-6-4-5-8-12-10;2*1-2/h3,6-7H,1-2,4-5,8H2;2*1-2H3/b11-7+;; |
| InChIKey | WIOLLSNCHWFCFF-FCVAESPPSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|