C10H13NS — CID 143157767
N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine (PubChem CID 143157767) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine.
| Compound Name | N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 143157767 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-thiopyran-6-yl)ethenyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C(=C)C1=CCCCS1 |
| InChI | InChI=1S/C10H13NS/c1-3-7-11-9(2)10-6-4-5-8-12-10/h3,6-7H,1-2,4-5,8H2/b11-7+ |
| InChIKey | RAPYKNVAFIBCCA-YRNVUSSQSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|