C12H11NS — CID 123454593
(8E)-13-methyl-11λ4-thia-7-azatricyclo[9.1.1.03,8]trideca-1(12),2,4,6,8,10-hexaene (PubChem CID 123454593) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is (8E)-13-methyl-11λ4-thia-7-azatricyclo[9.1.1.03,8]trideca-1(12),2,4,6,8,10-hexaene.
| Compound Name | (8E)-13-methyl-11λ4-thia-7-azatricyclo[9.1.1.03,8]trideca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 123454593 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (8E)-13-methyl-11λ4-thia-7-azatricyclo[9.1.1.03,8]trideca-1(12),2,4,6,8,10-hexaene |
| SMILES | CC1C2=CS1=C/C=c1/ncccc1=C2 |
| InChI | InChI=1S/C12H11NS/c1-9-11-7-10-3-2-5-13-12(10)4-6-14(9)8-11/h2-9H,1H3/b6-4?,10-7?,11-7?,12-4+ |
| InChIKey | ZMOOSVAFJNTOCC-GMHDRMJCSA-N |
| XLogP | 1.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|