C9H13NS — CID 145388228
N-(2-ethylsulfanylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 145388228) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclohexa-1,5-dien-1-yl)methanimine.
| Compound Name | N-(2-ethylsulfanylcyclohexa-1,5-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 145388228 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | N-(2-ethylsulfanylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | C=NC1=C(SCC)CCC=C1 |
| InChI | InChI=1S/C9H13NS/c1-3-11-9-7-5-4-6-8(9)10-2/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | XOUZSDNLWHPKRQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|