C10H11NS — CID 143216583
N-(2-ethenylsulfanylcyclohepta-1,3,6-trien-1-yl)methanimine (PubChem CID 143216583) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is N-(2-ethenylsulfanylcyclohepta-1,3,6-trien-1-yl)methanimine.
| Compound Name | N-(2-ethenylsulfanylcyclohepta-1,3,6-trien-1-yl)methanimine |
|---|---|
| PubChem CID | 143216583 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | N-(2-ethenylsulfanylcyclohepta-1,3,6-trien-1-yl)methanimine |
| SMILES | C=CSC1=C(N=C)C=CCC=C1 |
| InChI | InChI=1S/C10H11NS/c1-3-12-10-8-6-4-5-7-9(10)11-2/h3,5-8H,1-2,4H2 |
| InChIKey | PXDKPZYKOQSEEB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|