C8H7NS — CID 144689340
8aH-cyclohepta[d][1,3]thiazole (PubChem CID 144689340) has the molecular formula C8H7NS and a molecular weight of 149.22 g/mol. Its IUPAC name is 8aH-cyclohepta[d][1,3]thiazole.
| Compound Name | 8aH-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 144689340 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 8aH-cyclohepta[d][1,3]thiazole |
| SMILES | C1=CC=C2N=CSC2C=C1 |
| InChI | InChI=1S/C8H7NS/c1-2-4-7-8(5-3-1)10-6-9-7/h1-6,8H |
| InChIKey | UUQNIOPKCUHEKQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |