C9H9NS2 — CID 144790117
7-methylcyclohepta[d][1,3]thiazole-7-thiol (PubChem CID 144790117) has the molecular formula C9H9NS2 and a molecular weight of 195.31 g/mol. Its IUPAC name is 7-methylcyclohepta[d][1,3]thiazole-7-thiol.
| Compound Name | 7-methylcyclohepta[d][1,3]thiazole-7-thiol |
|---|---|
| PubChem CID | 144790117 |
| Molecular Formula | C9H9NS2 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 7-methylcyclohepta[d][1,3]thiazole-7-thiol |
| SMILES | CC1(S)C=CC=c2ncsc2=C1 |
| InChI | InChI=1S/C9H9NS2/c1-9(11)4-2-3-7-8(5-9)12-6-10-7/h2-6,11H,1H3 |
| InChIKey | LGBSQFYLXMFWRS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|