C9H8FNS — CID 170757459
5-fluoro-7-methyl-7H-cyclohepta[d][1,3]thiazole (PubChem CID 170757459) has the molecular formula C9H8FNS and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-fluoro-7-methyl-7H-cyclohepta[d][1,3]thiazole.
| Compound Name | 5-fluoro-7-methyl-7H-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 170757459 |
| Molecular Formula | C9H8FNS |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-fluoro-7-methyl-7H-cyclohepta[d][1,3]thiazole |
| SMILES | CC1C=C(F)C=c2ncsc2=C1 |
| InChI | InChI=1S/C9H8FNS/c1-6-2-7(10)4-8-9(3-6)12-5-11-8/h2-6H,1H3 |
| InChIKey | XYTISJHGQQKBJL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |