C10H13NS — CID 123560106
6-ethyl-6,7-dihydro-5H-cyclohepta[d][1,3]thiazole (PubChem CID 123560106) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 6-ethyl-6,7-dihydro-5H-cyclohepta[d][1,3]thiazole.
| Compound Name | 6-ethyl-6,7-dihydro-5H-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 123560106 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 6-ethyl-6,7-dihydro-5H-cyclohepta[d][1,3]thiazole |
| SMILES | CCC1CC=c2ncsc2=CC1 |
| InChI | InChI=1S/C10H13NS/c1-2-8-3-5-9-10(6-4-8)12-7-11-9/h5-8H,2-4H2,1H3 |
| InChIKey | TVTJXBDPKXTBHI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |