C11H13NS — CID 143108302
ethane;5-methylcyclohepta[d][1,3]thiazole (PubChem CID 143108302) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is ethane;5-methylcyclohepta[d][1,3]thiazole.
| Compound Name | ethane;5-methylcyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 143108302 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | ethane;5-methylcyclohepta[d][1,3]thiazole |
| SMILES | CC.CC1=CC=C=c2scnc2=C1 |
| InChI | InChI=1S/C9H7NS.C2H6/c1-7-3-2-4-9-8(5-7)10-6-11-9;1-2/h2-3,5-6H,1H3;1-2H3 |
| InChIKey | OKGGMLAOCPTZTG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |