C8H6NSV- — CID 58775489
4-methyl-6H-1,3-benzothiazol-6-ide;vanadium (PubChem CID 58775489) has the molecular formula C8H6NSV- and a molecular weight of 199.15 g/mol. Its IUPAC name is 4-methyl-6H-1,3-benzothiazol-6-ide;vanadium.
| Compound Name | 4-methyl-6H-1,3-benzothiazol-6-ide;vanadium |
|---|---|
| PubChem CID | 58775489 |
| Molecular Formula | C8H6NSV- |
| Molecular Weight | 199.15 g/mol |
| Exact Mass | 198.97 |
| IUPAC Name | 4-methyl-6H-1,3-benzothiazol-6-ide;vanadium |
| SMILES | Cc1c[c-]cc2scnc12.[V] |
| InChI | InChI=1S/C8H6NS.V/c1-6-3-2-4-7-8(6)9-5-10-7;/h3-5H,1H3;/q-1; |
| InChIKey | DKQGJHUUIHKHSH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|