C9H13NS — CID 145058029
5,6-dihydro-1,3-benzothiazole;ethane (PubChem CID 145058029) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 5,6-dihydro-1,3-benzothiazole;ethane.
| Compound Name | 5,6-dihydro-1,3-benzothiazole;ethane |
|---|---|
| PubChem CID | 145058029 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 5,6-dihydro-1,3-benzothiazole;ethane |
| SMILES | C1=c2ncsc2=CCC1.CC |
| InChI | InChI=1S/C7H7NS.C2H6/c1-2-4-7-6(3-1)8-5-9-7;1-2/h3-5H,1-2H2;1-2H3 |
| InChIKey | AVWIAAITPWTALO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |