C9H12NS+ — CID 59289934
2,3-dimethyl-5,6-dihydro-1,3-benzothiazol-3-ium (PubChem CID 59289934) has the molecular formula C9H12NS+ and a molecular weight of 166.27 g/mol. Its IUPAC name is 2,3-dimethyl-5,6-dihydro-1,3-benzothiazol-3-ium.
| Compound Name | 2,3-dimethyl-5,6-dihydro-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 59289934 |
| Molecular Formula | C9H12NS+ |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 2,3-dimethyl-5,6-dihydro-1,3-benzothiazol-3-ium |
| SMILES | Cc1sc2c([n+]1C)=CCCC=2 |
| InChI | InChI=1S/C9H12NS/c1-7-10(2)8-5-3-4-6-9(8)11-7/h5-6H,3-4H2,1-2H3/q+1 |
| InChIKey | JXDHXGYWJQSKGA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|