C11H12FNS — CID 170755443
7-ethyl-5-fluoro-7-methylcyclohepta[d][1,3]thiazole (PubChem CID 170755443) has the molecular formula C11H12FNS and a molecular weight of 209.29 g/mol. Its IUPAC name is 7-ethyl-5-fluoro-7-methylcyclohepta[d][1,3]thiazole.
| Compound Name | 7-ethyl-5-fluoro-7-methylcyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 170755443 |
| Molecular Formula | C11H12FNS |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 7-ethyl-5-fluoro-7-methylcyclohepta[d][1,3]thiazole |
| SMILES | CCC1(C)C=C(F)C=c2ncsc2=C1 |
| InChI | InChI=1S/C11H12FNS/c1-3-11(2)5-8(12)4-9-10(6-11)14-7-13-9/h4-7H,3H2,1-2H3 |
| InChIKey | HCLVABPMEWXULD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |