C14H19NS — CID 142847482
(4E)-4-[(2E,4Z)-2-tert-butylhexa-2,4-dienylidene]-5-methylidene-1,3-thiazole (PubChem CID 142847482) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is (4E)-4-[(2E,4Z)-2-tert-butylhexa-2,4-dienylidene]-5-methylidene-1,3-thiazole.
| Compound Name | (4E)-4-[(2E,4Z)-2-tert-butylhexa-2,4-dienylidene]-5-methylidene-1,3-thiazole |
|---|---|
| PubChem CID | 142847482 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (4E)-4-[(2E,4Z)-2-tert-butylhexa-2,4-dienylidene]-5-methylidene-1,3-thiazole |
| SMILES | C=c1scn/c1=C/C(=C\C=C/C)C(C)(C)C |
| InChI | InChI=1S/C14H19NS/c1-6-7-8-12(14(3,4)5)9-13-11(2)16-10-15-13/h6-10H,2H2,1,3-5H3/b7-6-,12-8+,13-9+ |
| InChIKey | UWMDWGTYMVVFLA-CYAJVYQESA-N |
| XLogP | 2.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|