C14H21NS — CID 143877837
ethane;7-methyl-7-propan-2-ylcyclohepta[d][1,3]thiazole (PubChem CID 143877837) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is ethane;7-methyl-7-propan-2-ylcyclohepta[d][1,3]thiazole.
| Compound Name | ethane;7-methyl-7-propan-2-ylcyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 143877837 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | ethane;7-methyl-7-propan-2-ylcyclohepta[d][1,3]thiazole |
| SMILES | CC.CC(C)C1(C)C=CC=c2ncsc2=C1 |
| InChI | InChI=1S/C12H15NS.C2H6/c1-9(2)12(3)6-4-5-10-11(7-12)14-8-13-10;1-2/h4-9H,1-3H3;1-2H3 |
| InChIKey | UFNZXXKQCCOVPA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |