C16H27NS — CID 144512962
7-butan-2-yl-5H-cyclohepta[d][1,3]thiazole;ethane (PubChem CID 144512962) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is 7-butan-2-yl-5H-cyclohepta[d][1,3]thiazole;ethane.
| Compound Name | 7-butan-2-yl-5H-cyclohepta[d][1,3]thiazole;ethane |
|---|---|
| PubChem CID | 144512962 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 7-butan-2-yl-5H-cyclohepta[d][1,3]thiazole;ethane |
| SMILES | CC.CC.CCC(C)C1=CCC=c2ncsc2=C1 |
| InChI | InChI=1S/C12H15NS.2C2H6/c1-3-9(2)10-5-4-6-11-12(7-10)14-8-13-11;2*1-2/h5-9H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | BVYUKRFVXZZTRK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |