C9H9NS — CID 147881718
7-methyl-7H-cyclohepta[d][1,3]thiazole (PubChem CID 147881718) has the molecular formula C9H9NS and a molecular weight of 163.25 g/mol. Its IUPAC name is 7-methyl-7H-cyclohepta[d][1,3]thiazole.
| Compound Name | 7-methyl-7H-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 147881718 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 7-methyl-7H-cyclohepta[d][1,3]thiazole |
| SMILES | CC1C=CC=c2ncsc2=C1 |
| InChI | InChI=1S/C9H9NS/c1-7-3-2-4-8-9(5-7)11-6-10-8/h2-7H,1H3 |
| InChIKey | IAOHYRSGYCWLPY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |