C13H17NS — CID 145130228
5-(2-methylbutan-2-yl)-5H-cyclohepta[d][1,3]thiazole (PubChem CID 145130228) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 5-(2-methylbutan-2-yl)-5H-cyclohepta[d][1,3]thiazole.
| Compound Name | 5-(2-methylbutan-2-yl)-5H-cyclohepta[d][1,3]thiazole |
|---|---|
| PubChem CID | 145130228 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 5-(2-methylbutan-2-yl)-5H-cyclohepta[d][1,3]thiazole |
| SMILES | CCC(C)(C)C1C=CC=c2scnc2=C1 |
| InChI | InChI=1S/C13H17NS/c1-4-13(2,3)10-6-5-7-12-11(8-10)14-9-15-12/h5-10H,4H2,1-3H3 |
| InChIKey | BFDVNPYYVFBTJY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |