C13H19NS — CID 145130285
5-ethyl-5H-cyclohepta[d][1,3]thiazole;propane (PubChem CID 145130285) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 5-ethyl-5H-cyclohepta[d][1,3]thiazole;propane.
| Compound Name | 5-ethyl-5H-cyclohepta[d][1,3]thiazole;propane |
|---|---|
| PubChem CID | 145130285 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-ethyl-5H-cyclohepta[d][1,3]thiazole;propane |
| SMILES | CCC.CCC1C=CC=c2scnc2=C1 |
| InChI | InChI=1S/C10H11NS.C3H8/c1-2-8-4-3-5-10-9(6-8)11-7-12-10;1-3-2/h3-8H,2H2,1H3;3H2,1-2H3 |
| InChIKey | FLTZSICNZPYSFD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |