C9H11NS — CID 143838540
3-methyl-7,8-dihydro-2H-1,4-benzothiazine (PubChem CID 143838540) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 3-methyl-7,8-dihydro-2H-1,4-benzothiazine.
| Compound Name | 3-methyl-7,8-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 143838540 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3-methyl-7,8-dihydro-2H-1,4-benzothiazine |
| SMILES | CC1=NC2=C(CCC=C2)SC1 |
| InChI | InChI=1S/C9H11NS/c1-7-6-11-9-5-3-2-4-8(9)10-7/h2,4H,3,5-6H2,1H3 |
| InChIKey | JHBLDLYRNUCLTO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |