C8H11NS — CID 123551484
N-(6-methylsulfanylcyclohexa-1,3-dien-1-yl)methanimine (PubChem CID 123551484) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is N-(6-methylsulfanylcyclohexa-1,3-dien-1-yl)methanimine.
| Compound Name | N-(6-methylsulfanylcyclohexa-1,3-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 123551484 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | N-(6-methylsulfanylcyclohexa-1,3-dien-1-yl)methanimine |
| SMILES | C=NC1=CC=CCC1SC |
| InChI | InChI=1S/C8H11NS/c1-9-7-5-3-4-6-8(7)10-2/h3-5,8H,1,6H2,2H3 |
| InChIKey | AFBDJOCTPOROLT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|