C10H13NS — CID 143987850
5,6-bis(prop-1-en-2-yl)-2H-1,4-thiazine (PubChem CID 143987850) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 5,6-bis(prop-1-en-2-yl)-2H-1,4-thiazine.
| Compound Name | 5,6-bis(prop-1-en-2-yl)-2H-1,4-thiazine |
|---|---|
| PubChem CID | 143987850 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5,6-bis(prop-1-en-2-yl)-2H-1,4-thiazine |
| SMILES | C=C(C)C1=C(C(=C)C)SCC=N1 |
| InChI | InChI=1S/C10H13NS/c1-7(2)9-10(8(3)4)12-6-5-11-9/h5H,1,3,6H2,2,4H3 |
| InChIKey | PDGZQTGXDXVNJR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |