C10H15NS — CID 143533258
N-(5-ethenyl-1-methylidene-3,6-dihydro-2H-thiopyran-4-yl)ethanimine (PubChem CID 143533258) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is N-(5-ethenyl-1-methylidene-3,6-dihydro-2H-thiopyran-4-yl)ethanimine.
| Compound Name | N-(5-ethenyl-1-methylidene-3,6-dihydro-2H-thiopyran-4-yl)ethanimine |
|---|---|
| PubChem CID | 143533258 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(5-ethenyl-1-methylidene-3,6-dihydro-2H-thiopyran-4-yl)ethanimine |
| SMILES | C=CC1=C(/N=C/C)CCS(=C)C1 |
| InChI | InChI=1S/C10H15NS/c1-4-9-8-12(3)7-6-10(9)11-5-2/h4-5H,1,3,6-8H2,2H3/b11-5+ |
| InChIKey | PKIKEVXGWNRBBG-VZUCSPMQSA-N |
| XLogP | 2.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|