C11H15NS — CID 143533183
3,3-dimethyl-8,9-dihydro-6H-thiopyrano[4,3-b]azepine (PubChem CID 143533183) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 3,3-dimethyl-8,9-dihydro-6H-thiopyrano[4,3-b]azepine.
| Compound Name | 3,3-dimethyl-8,9-dihydro-6H-thiopyrano[4,3-b]azepine |
|---|---|
| PubChem CID | 143533183 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3,3-dimethyl-8,9-dihydro-6H-thiopyrano[4,3-b]azepine |
| SMILES | CC1(C)C=CC2=C(CCSC2)N=C1 |
| InChI | InChI=1S/C11H15NS/c1-11(2)5-3-9-7-13-6-4-10(9)12-8-11/h3,5,8H,4,6-7H2,1-2H3 |
| InChIKey | FRCKVOBISJQJLK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |