About 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine
7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine (PubChem CID 143533133) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine.
Analyze 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine?
The IUPAC name of 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine (CID 143533133) is 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine.
What is the SMILES notation for 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine?
The canonical SMILES for 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine is CC1C=CC2=C(C=N1)CCSC2.
What is the InChIKey of 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine?
The InChIKey is PKRIBYAEQLAKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NS/c1-8-2-3-10-7-12-5-4-9(10)6-11-8/h2-3,6,8H,4-5,7H2,1H3.
What are the key properties of 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine?
7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine has a molecular weight of 179.29 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,3,4,7-tetrahydrothiopyrano[4,3-c]azepine is sourced from PubChem (CID 143533133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).