C18H25N5O2 — CID 143491436
7-acetyl-6-(3-aminopiperidin-1-yl)-5-(3-methylbut-2-enyl)-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 143491436) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 7-acetyl-6-(3-aminopiperidin-1-yl)-5-(3-methylbut-2-enyl)-3H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-acetyl-6-(3-aminopiperidin-1-yl)-5-(3-methylbut-2-enyl)-3H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 143491436 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 7-acetyl-6-(3-aminopiperidin-1-yl)-5-(3-methylbut-2-enyl)-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CC(=O)c1c(N2CCCC(N)C2)n(CC=C(C)C)c2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C18H25N5O2/c1-11(2)6-8-23-16-15(20-10-21-17(16)25)14(12(3)24)18(23)22-7-4-5-13(19)9-22/h6,10,13H,4-5,7-9,19H2,1-3H3,(H,20,21,25) |
| InChIKey | HNWCDRBMXKOQLN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|