C18H27N7O3 — CID 57499225
2-[8-(3-aminopiperidin-1-yl)-1-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-3-yl]acetamide (PubChem CID 57499225) has the molecular formula C18H27N7O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[8-(3-aminopiperidin-1-yl)-1-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-3-yl]acetamide.
| Compound Name | 2-[8-(3-aminopiperidin-1-yl)-1-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-3-yl]acetamide |
|---|---|
| PubChem CID | 57499225 |
| Molecular Formula | C18H27N7O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2-[8-(3-aminopiperidin-1-yl)-1-methyl-7-(3-methylbut-2-enyl)-2,6-dioxopurin-3-yl]acetamide |
| SMILES | CC(C)=CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(C)c(=O)n2CC(N)=O |
| InChI | InChI=1S/C18H27N7O3/c1-11(2)6-8-24-14-15(21-17(24)23-7-4-5-12(19)9-23)25(10-13(20)26)18(28)22(3)16(14)27/h6,12H,4-5,7-10,19H2,1-3H3,(H2,20,26) |
| InChIKey | JDOICCILOUHSRI-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|