C22H37N7O2 — CID 57499203
8-(3-aminopiperidin-1-yl)-3-[2-(diethylamino)ethyl]-1-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione (PubChem CID 57499203) has the molecular formula C22H37N7O2 and a molecular weight of 431.59 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3-[2-(diethylamino)ethyl]-1-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3-[2-(diethylamino)ethyl]-1-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
|---|---|
| PubChem CID | 57499203 |
| Molecular Formula | C22H37N7O2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3-[2-(diethylamino)ethyl]-1-methyl-7-(3-methylbut-2-enyl)purine-2,6-dione |
| SMILES | CCN(CC)CCn1c(=O)n(C)c(=O)c2c1nc(N1CCCC(N)C1)n2CC=C(C)C |
| InChI | InChI=1S/C22H37N7O2/c1-6-26(7-2)13-14-29-19-18(20(30)25(5)22(29)31)28(12-10-16(3)4)21(24-19)27-11-8-9-17(23)15-27/h10,17H,6-9,11-15,23H2,1-5H3 |
| InChIKey | TZJUQMBCVRZAMA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|