C17H22N4O2 — CID 143492271
[(E)-[2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-[(3E)-hexa-1,3,5-trien-3-yl]carbamate (PubChem CID 143492271) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is [(E)-[2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-[(3E)-hexa-1,3,5-trien-3-yl]carbamate.
| Compound Name | [(E)-[2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-[(3E)-hexa-1,3,5-trien-3-yl]carbamate |
|---|---|
| PubChem CID | 143492271 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [(E)-[2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-[(3E)-hexa-1,3,5-trien-3-yl]carbamate |
| SMILES | C=C/C=C(\C=C)NC(=O)O/N=C1\CCCCC1Cn1ccnc1 |
| InChI | InChI=1S/C17H22N4O2/c1-3-7-15(4-2)19-17(22)23-20-16-9-6-5-8-14(16)12-21-11-10-18-13-21/h3-4,7,10-11,13-14H,1-2,5-6,8-9,12H2,(H,19,22)/b15-7+,20-16+ |
| InChIKey | UWKSGZXOUVYCQY-CBBFPEKSSA-N |
| XLogP | 3.41 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|