C17H19ClN4O2 — CID 6927345
[(Z)-[(2R)-2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-(4-chlorophenyl)carbamate (PubChem CID 6927345) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is [(Z)-[(2R)-2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-(4-chlorophenyl)carbamate.
| Compound Name | [(Z)-[(2R)-2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 6927345 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(Z)-[(2R)-2-(imidazol-1-ylmethyl)cyclohexylidene]amino] N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)O/N=C1/CCCC[C@@H]1Cn1ccnc1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-14-5-7-15(8-6-14)20-17(23)24-21-16-4-2-1-3-13(16)11-22-10-9-19-12-22/h5-10,12-13H,1-4,11H2,(H,20,23)/b21-16-/t13-/m1/s1 |
| InChIKey | RAVRMCSMBCNRNQ-QIAIEURZSA-N |
| XLogP | 4.33 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|