C23H32N6O2 — CID 86933267
4-(cyclohexylcarbamoylamino)-N-[4-(imidazol-1-ylmethyl)phenyl]piperidine-1-carboxamide (PubChem CID 86933267) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[4-(imidazol-1-ylmethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[4-(imidazol-1-ylmethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86933267 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[4-(imidazol-1-ylmethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)NC1CCN(C(=O)Nc2ccc(Cn3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C23H32N6O2/c30-22(25-19-4-2-1-3-5-19)26-21-10-13-29(14-11-21)23(31)27-20-8-6-18(7-9-20)16-28-15-12-24-17-28/h6-9,12,15,17,19,21H,1-5,10-11,13-14,16H2,(H,27,31)(H2,25,26,30) |
| InChIKey | KXHQKHJTHBNAOU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |