C25H29N5O2 — CID 155950924
N'-[4-(imidazol-1-ylmethyl)phenyl]-N-[4-(2-piperidin-1-ylethyl)phenyl]oxamide (PubChem CID 155950924) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N'-[4-(imidazol-1-ylmethyl)phenyl]-N-[4-(2-piperidin-1-ylethyl)phenyl]oxamide.
| Compound Name | N'-[4-(imidazol-1-ylmethyl)phenyl]-N-[4-(2-piperidin-1-ylethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 155950924 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | N'-[4-(imidazol-1-ylmethyl)phenyl]-N-[4-(2-piperidin-1-ylethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc(CCN2CCCCC2)cc1)C(=O)Nc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C25H29N5O2/c31-24(25(32)28-23-10-6-21(7-11-23)18-30-17-13-26-19-30)27-22-8-4-20(5-9-22)12-16-29-14-2-1-3-15-29/h4-11,13,17,19H,1-3,12,14-16,18H2,(H,27,31)(H,28,32) |
| InChIKey | WWMOVDLDVKQVOF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|