C26H31N5O2 — CID 155945405
N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-[4-(2-piperidin-1-ylethyl)phenyl]oxamide (PubChem CID 155945405) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-[4-(2-piperidin-1-ylethyl)phenyl]oxamide.
| Compound Name | N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-[4-(2-piperidin-1-ylethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 155945405 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-N'-[4-(2-piperidin-1-ylethyl)phenyl]oxamide |
| SMILES | O=C(NCc1cccc(Cn2ccnc2)c1)C(=O)Nc1ccc(CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C26H31N5O2/c32-25(28-18-22-5-4-6-23(17-22)19-31-16-12-27-20-31)26(33)29-24-9-7-21(8-10-24)11-15-30-13-2-1-3-14-30/h4-10,12,16-17,20H,1-3,11,13-15,18-19H2,(H,28,32)(H,29,33) |
| InChIKey | ASXJMWRGNZSSTD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|